C27H29N5O4 — CID 145060443
4-(furan-2-yl)-N-(1-hydroxycyclopropyl)-N-[[2-[5-(2H-tetrazol-5-yl)pentoxy]phenyl]methyl]benzamide (PubChem CID 145060443) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-(1-hydroxycyclopropyl)-N-[[2-[5-(2H-tetrazol-5-yl)pentoxy]phenyl]methyl]benzamide.
| Compound Name | 4-(furan-2-yl)-N-(1-hydroxycyclopropyl)-N-[[2-[5-(2H-tetrazol-5-yl)pentoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 145060443 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 4-(furan-2-yl)-N-(1-hydroxycyclopropyl)-N-[[2-[5-(2H-tetrazol-5-yl)pentoxy]phenyl]methyl]benzamide |
| SMILES | O=C(c1ccc(-c2ccco2)cc1)N(Cc1ccccc1OCCCCCc1nn[nH]n1)C1(O)CC1 |
| InChI | InChI=1S/C27H29N5O4/c33-26(21-13-11-20(12-14-21)23-9-6-18-36-23)32(27(34)15-16-27)19-22-7-3-4-8-24(22)35-17-5-1-2-10-25-28-30-31-29-25/h3-4,6-9,11-14,18,34H,1-2,5,10,15-17,19H2,(H,28,29,30,31) |
| InChIKey | DJKDBLJAKSPLJO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|