C24H25N5O3 — CID 121270177
4-(furan-2-yl)-N-[[2-[4-(2H-tetrazol-5-yl)butoxy]phenyl]methyl]-N-(trideuteriomethyl)benzamide (PubChem CID 121270177) has the molecular formula C24H25N5O3 and a molecular weight of 434.51 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-[[2-[4-(2H-tetrazol-5-yl)butoxy]phenyl]methyl]-N-(trideuteriomethyl)benzamide.
| Compound Name | 4-(furan-2-yl)-N-[[2-[4-(2H-tetrazol-5-yl)butoxy]phenyl]methyl]-N-(trideuteriomethyl)benzamide |
|---|---|
| PubChem CID | 121270177 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-(furan-2-yl)-N-[[2-[4-(2H-tetrazol-5-yl)butoxy]phenyl]methyl]-N-(trideuteriomethyl)benzamide |
| SMILES | [2H]C([2H])([2H])N(Cc1ccccc1OCCCCc1nn[nH]n1)C(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C24H25N5O3/c1-29(24(30)19-13-11-18(12-14-19)21-9-6-16-32-21)17-20-7-2-3-8-22(20)31-15-5-4-10-23-25-27-28-26-23/h2-3,6-9,11-14,16H,4-5,10,15,17H2,1H3,(H,25,26,27,28)/i1D3 |
| InChIKey | BAYVLLMVYFELAD-FIBGUPNXSA-N |
| XLogP | 4.13 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|