C28H35NO5S — CID 145061898
ethane;ethyl 2-[3-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]propylsulfanyl]acetate (PubChem CID 145061898) has the molecular formula C28H35NO5S and a molecular weight of 497.66 g/mol. Its IUPAC name is ethane;ethyl 2-[3-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]propylsulfanyl]acetate.
| Compound Name | ethane;ethyl 2-[3-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]propylsulfanyl]acetate |
|---|---|
| PubChem CID | 145061898 |
| Molecular Formula | C28H35NO5S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | ethane;ethyl 2-[3-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]propylsulfanyl]acetate |
| SMILES | CC.CCOC(=O)CSCCCOc1ccccc1CN(C)C(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C26H29NO5S.C2H6/c1-3-30-25(28)19-33-17-7-16-32-24-9-5-4-8-22(24)18-27(2)26(29)21-13-11-20(12-14-21)23-10-6-15-31-23;1-2/h4-6,8-15H,3,7,16-19H2,1-2H3;1-2H3 |
| InChIKey | WFPKTDPVHKVZIR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|