C29H35NO4 — CID 145060930
4-(furan-2-yl)-N-[(2-hexoxyphenyl)methyl]-N-(1-hydroxycyclopentyl)benzamide (PubChem CID 145060930) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-[(2-hexoxyphenyl)methyl]-N-(1-hydroxycyclopentyl)benzamide.
| Compound Name | 4-(furan-2-yl)-N-[(2-hexoxyphenyl)methyl]-N-(1-hydroxycyclopentyl)benzamide |
|---|---|
| PubChem CID | 145060930 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 4-(furan-2-yl)-N-[(2-hexoxyphenyl)methyl]-N-(1-hydroxycyclopentyl)benzamide |
| SMILES | CCCCCCOc1ccccc1CN(C(=O)c1ccc(-c2ccco2)cc1)C1(O)CCCC1 |
| InChI | InChI=1S/C29H35NO4/c1-2-3-4-9-20-33-27-12-6-5-11-25(27)22-30(29(32)18-7-8-19-29)28(31)24-16-14-23(15-17-24)26-13-10-21-34-26/h5-6,10-17,21,32H,2-4,7-9,18-20,22H2,1H3 |
| InChIKey | NJGWKLOQKRKCSX-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|