C27H33NO5 — CID 145061032
4-(furan-2-yl)-N-[(2-hexoxyphenyl)-dihydroxymethyl]-N-propan-2-ylbenzamide (PubChem CID 145061032) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-[(2-hexoxyphenyl)-dihydroxymethyl]-N-propan-2-ylbenzamide.
| Compound Name | 4-(furan-2-yl)-N-[(2-hexoxyphenyl)-dihydroxymethyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 145061032 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 4-(furan-2-yl)-N-[(2-hexoxyphenyl)-dihydroxymethyl]-N-propan-2-ylbenzamide |
| SMILES | CCCCCCOc1ccccc1C(O)(O)N(C(=O)c1ccc(-c2ccco2)cc1)C(C)C |
| InChI | InChI=1S/C27H33NO5/c1-4-5-6-9-18-33-25-12-8-7-11-23(25)27(30,31)28(20(2)3)26(29)22-16-14-21(15-17-22)24-13-10-19-32-24/h7-8,10-17,19-20,30-31H,4-6,9,18H2,1-3H3 |
| InChIKey | HZZBWRSSDGUFJI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|