C28H33NO6 — CID 121270582
6-[2-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)benzoyl]amino]methyl]-4-methoxyphenoxy]hexanoic acid (PubChem CID 121270582) has the molecular formula C28H33NO6 and a molecular weight of 480.58 g/mol. Its IUPAC name is 6-[2-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)benzoyl]amino]methyl]-4-methoxyphenoxy]hexanoic acid.
| Compound Name | 6-[2-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)benzoyl]amino]methyl]-4-methoxyphenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270582 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 6-[2-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)benzoyl]amino]methyl]-4-methoxyphenoxy]hexanoic acid |
| SMILES | [2H]C(C)(C)N(Cc1cc(OC)ccc1OCCCCCC(=O)O)C(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C28H33NO6/c1-20(2)29(28(32)22-12-10-21(11-13-22)25-8-7-17-35-25)19-23-18-24(33-3)14-15-26(23)34-16-6-4-5-9-27(30)31/h7-8,10-15,17-18,20H,4-6,9,16,19H2,1-3H3,(H,30,31)/i20D |
| InChIKey | OWZGUPISVMEALN-YVHRXSIGSA-N |
| XLogP | 6.03 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|