C27H30FNO5 — CID 121270663
6-[2-[deuterio-[[4-(furan-2-yl)benzoyl]-propan-2-ylamino]methyl]-4-fluorophenoxy]hexanoic acid (PubChem CID 121270663) has the molecular formula C27H30FNO5 and a molecular weight of 468.54 g/mol. Its IUPAC name is 6-[2-[deuterio-[[4-(furan-2-yl)benzoyl]-propan-2-ylamino]methyl]-4-fluorophenoxy]hexanoic acid.
| Compound Name | 6-[2-[deuterio-[[4-(furan-2-yl)benzoyl]-propan-2-ylamino]methyl]-4-fluorophenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270663 |
| Molecular Formula | C27H30FNO5 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 6-[2-[deuterio-[[4-(furan-2-yl)benzoyl]-propan-2-ylamino]methyl]-4-fluorophenoxy]hexanoic acid |
| SMILES | [2H]C(c1cc(F)ccc1OCCCCCC(=O)O)N(C(=O)c1ccc(-c2ccco2)cc1)C(C)C |
| InChI | InChI=1S/C27H30FNO5/c1-19(2)29(27(32)21-11-9-20(10-12-21)24-7-6-16-34-24)18-22-17-23(28)13-14-25(22)33-15-5-3-4-8-26(30)31/h6-7,9-14,16-17,19H,3-5,8,15,18H2,1-2H3,(H,30,31)/i18D |
| InChIKey | BHQQCTDYYKLCSB-VAAKKRCDSA-N |
| XLogP | 6.16 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|