C30H32F3NO3 — CID 145060556
N-[(2-hexoxyphenyl)methyl]-N-(1-hydroxycyclopropyl)-4-[2-(trifluoromethyl)phenyl]benzamide (PubChem CID 145060556) has the molecular formula C30H32F3NO3 and a molecular weight of 511.58 g/mol. Its IUPAC name is N-[(2-hexoxyphenyl)methyl]-N-(1-hydroxycyclopropyl)-4-[2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[(2-hexoxyphenyl)methyl]-N-(1-hydroxycyclopropyl)-4-[2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 145060556 |
| Molecular Formula | C30H32F3NO3 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | N-[(2-hexoxyphenyl)methyl]-N-(1-hydroxycyclopropyl)-4-[2-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCCCCCOc1ccccc1CN(C(=O)c1ccc(-c2ccccc2C(F)(F)F)cc1)C1(O)CC1 |
| InChI | InChI=1S/C30H32F3NO3/c1-2-3-4-9-20-37-27-13-8-5-10-24(27)21-34(29(36)18-19-29)28(35)23-16-14-22(15-17-23)25-11-6-7-12-26(25)30(31,32)33/h5-8,10-17,36H,2-4,9,18-21H2,1H3 |
| InChIKey | XWFMTTMRWHVGOC-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|