C29H30N2O4S — CID 121270299
N-cyclopropyl-N-[dideuterio-[2-[5-(3-oxo-1,2-thiazol-5-yl)pentoxy]phenyl]methyl]-4-(furan-2-yl)benzamide (PubChem CID 121270299) has the molecular formula C29H30N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is N-cyclopropyl-N-[dideuterio-[2-[5-(3-oxo-1,2-thiazol-5-yl)pentoxy]phenyl]methyl]-4-(furan-2-yl)benzamide.
| Compound Name | N-cyclopropyl-N-[dideuterio-[2-[5-(3-oxo-1,2-thiazol-5-yl)pentoxy]phenyl]methyl]-4-(furan-2-yl)benzamide |
|---|---|
| PubChem CID | 121270299 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-cyclopropyl-N-[dideuterio-[2-[5-(3-oxo-1,2-thiazol-5-yl)pentoxy]phenyl]methyl]-4-(furan-2-yl)benzamide |
| SMILES | [2H]C([2H])(c1ccccc1OCCCCCc1cc(=O)[nH]s1)N(C(=O)c1ccc(-c2ccco2)cc1)C1CC1 |
| InChI | InChI=1S/C29H30N2O4S/c32-28-19-25(36-30-28)8-2-1-5-17-34-27-9-4-3-7-23(27)20-31(24-15-16-24)29(33)22-13-11-21(12-14-22)26-10-6-18-35-26/h3-4,6-7,9-14,18-19,24H,1-2,5,8,15-17,20H2,(H,30,32)/i20D2 |
| InChIKey | ILPQYNLTBASUQS-FCLBBQIASA-N |
| XLogP | 6.29 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|