C31H35NO4 — CID 121270868
6-[2-[[cyclopropyl-[4-(2,3-dimethylphenyl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270868) has the molecular formula C31H35NO4 and a molecular weight of 486.63 g/mol. Its IUPAC name is 6-[2-[[cyclopropyl-[4-(2,3-dimethylphenyl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopropyl-[4-(2,3-dimethylphenyl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270868 |
| Molecular Formula | C31H35NO4 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 6-[2-[[cyclopropyl-[4-(2,3-dimethylphenyl)benzoyl]amino]-deuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)O)N(C(=O)c1ccc(-c2cccc(C)c2C)cc1)C1CC1 |
| InChI | InChI=1S/C31H35NO4/c1-22-9-8-11-28(23(22)2)24-14-16-25(17-15-24)31(35)32(27-18-19-27)21-26-10-5-6-12-29(26)36-20-7-3-4-13-30(33)34/h5-6,8-12,14-17,27H,3-4,7,13,18-21H2,1-2H3,(H,33,34)/i21D |
| InChIKey | KFMROYGPDFKRJI-KRLANHAZSA-N |
| XLogP | 6.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|