C33H33NO4 — CID 121270749
6-[2-[[cyclopropyl-(4-naphthalen-1-ylbenzoyl)amino]-dideuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270749) has the molecular formula C33H33NO4 and a molecular weight of 509.64 g/mol. Its IUPAC name is 6-[2-[[cyclopropyl-(4-naphthalen-1-ylbenzoyl)amino]-dideuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[cyclopropyl-(4-naphthalen-1-ylbenzoyl)amino]-dideuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270749 |
| Molecular Formula | C33H33NO4 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 6-[2-[[cyclopropyl-(4-naphthalen-1-ylbenzoyl)amino]-dideuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C([2H])(c1ccccc1OCCCCCC(=O)O)N(C(=O)c1ccc(-c2cccc3ccccc23)cc1)C1CC1 |
| InChI | InChI=1S/C33H33NO4/c35-32(36)15-2-1-7-22-38-31-14-6-4-10-27(31)23-34(28-20-21-28)33(37)26-18-16-25(17-19-26)30-13-8-11-24-9-3-5-12-29(24)30/h3-6,8-14,16-19,28H,1-2,7,15,20-23H2,(H,35,36)/i23D2 |
| InChIKey | CGBJTUMKRFCROG-RVWBZSOGSA-N |
| XLogP | 7.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|