C27H28N2O5 — CID 121270555
6-[2-[[but-2-ynyl-[6-(furan-2-yl)pyridine-3-carbonyl]amino]-deuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270555) has the molecular formula C27H28N2O5 and a molecular weight of 461.54 g/mol. Its IUPAC name is 6-[2-[[but-2-ynyl-[6-(furan-2-yl)pyridine-3-carbonyl]amino]-deuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[but-2-ynyl-[6-(furan-2-yl)pyridine-3-carbonyl]amino]-deuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270555 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 6-[2-[[but-2-ynyl-[6-(furan-2-yl)pyridine-3-carbonyl]amino]-deuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)O)N(CC#CC)C(=O)c1ccc(-c2ccco2)nc1 |
| InChI | InChI=1S/C27H28N2O5/c1-2-3-16-29(27(32)21-14-15-23(28-19-21)25-12-9-18-34-25)20-22-10-6-7-11-24(22)33-17-8-4-5-13-26(30)31/h6-7,9-12,14-15,18-19H,4-5,8,13,16-17,20H2,1H3,(H,30,31)/i20D |
| InChIKey | NEERVQWTVWBUTF-YVHRXSIGSA-N |
| XLogP | 5.03 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|