C32H35NO7 — CID 145061145
6-[2-[[benzyl(methyl)amino]-dihydroxymethyl]phenoxy]hexanoic acid;4-(furan-2-yl)benzaldehyde (PubChem CID 145061145) has the molecular formula C32H35NO7 and a molecular weight of 545.63 g/mol. Its IUPAC name is 6-[2-[[benzyl(methyl)amino]-dihydroxymethyl]phenoxy]hexanoic acid;4-(furan-2-yl)benzaldehyde.
| Compound Name | 6-[2-[[benzyl(methyl)amino]-dihydroxymethyl]phenoxy]hexanoic acid;4-(furan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 145061145 |
| Molecular Formula | C32H35NO7 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 6-[2-[[benzyl(methyl)amino]-dihydroxymethyl]phenoxy]hexanoic acid;4-(furan-2-yl)benzaldehyde |
| SMILES | CN(Cc1ccccc1)C(O)(O)c1ccccc1OCCCCCC(=O)O.O=Cc1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C21H27NO5.C11H8O2/c1-22(16-17-10-4-2-5-11-17)21(25,26)18-12-7-8-13-19(18)27-15-9-3-6-14-20(23)24;12-8-9-3-5-10(6-4-9)11-2-1-7-13-11/h2,4-5,7-8,10-13,25-26H,3,6,9,14-16H2,1H3,(H,23,24);1-8H |
| InChIKey | YNLITYABSNQRFS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|