C25H29FN2O6 — CID 145060785
6-fluoropyridine-3-carbaldehyde;6-[2-[[[furan-2-yl(hydroxy)methyl]-methylamino]methyl]phenoxy]hexanoic acid (PubChem CID 145060785) has the molecular formula C25H29FN2O6 and a molecular weight of 472.51 g/mol. Its IUPAC name is 6-fluoropyridine-3-carbaldehyde;6-[2-[[[furan-2-yl(hydroxy)methyl]-methylamino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-fluoropyridine-3-carbaldehyde;6-[2-[[[furan-2-yl(hydroxy)methyl]-methylamino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 145060785 |
| Molecular Formula | C25H29FN2O6 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 6-fluoropyridine-3-carbaldehyde;6-[2-[[[furan-2-yl(hydroxy)methyl]-methylamino]methyl]phenoxy]hexanoic acid |
| SMILES | CN(Cc1ccccc1OCCCCCC(=O)O)C(O)c1ccco1.O=Cc1ccc(F)nc1 |
| InChI | InChI=1S/C19H25NO5.C6H4FNO/c1-20(19(23)17-10-7-13-25-17)14-15-8-4-5-9-16(15)24-12-6-2-3-11-18(21)22;7-6-2-1-5(4-9)3-8-6/h4-5,7-10,13,19,23H,2-3,6,11-12,14H2,1H3,(H,21,22);1-4H |
| InChIKey | YPPBAJHBXLMDLE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|