C19H21FN2O4 — CID 123766633
6-[2-[[(6-fluoropyridine-3-carbonyl)amino]methyl]phenoxy]hexanoic acid (PubChem CID 123766633) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is 6-[2-[[(6-fluoropyridine-3-carbonyl)amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[(6-fluoropyridine-3-carbonyl)amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 123766633 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 6-[2-[[(6-fluoropyridine-3-carbonyl)amino]methyl]phenoxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccccc1CNC(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C19H21FN2O4/c20-17-10-9-15(13-21-17)19(25)22-12-14-6-3-4-7-16(14)26-11-5-1-2-8-18(23)24/h3-4,6-7,9-10,13H,1-2,5,8,11-12H2,(H,22,25)(H,23,24) |
| InChIKey | CUWHIMQOIWXRSK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|