C26H36N2O5 — CID 130304169
6-[2-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)piperidine-1-carbonyl]amino]methyl]phenoxy]hexanoic acid (PubChem CID 130304169) has the molecular formula C26H36N2O5 and a molecular weight of 457.59 g/mol. Its IUPAC name is 6-[2-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)piperidine-1-carbonyl]amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)piperidine-1-carbonyl]amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 130304169 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 6-[2-[[2-deuteriopropan-2-yl-[4-(furan-2-yl)piperidine-1-carbonyl]amino]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(C)(C)N(Cc1ccccc1OCCCCCC(=O)O)C(=O)N1CCC(c2ccco2)CC1 |
| InChI | InChI=1S/C26H36N2O5/c1-20(2)28(26(31)27-15-13-21(14-16-27)23-11-8-18-33-23)19-22-9-5-6-10-24(22)32-17-7-3-4-12-25(29)30/h5-6,8-11,18,20-21H,3-4,7,12-17,19H2,1-2H3,(H,29,30)/i20D |
| InChIKey | VYVDNRYOVQWHPT-YVHRXSIGSA-N |
| XLogP | 5.51 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|