C22H25N3O7 — CID 123731747
6-[2-[[[5-(furan-2-yl)-3,6-dioxopiperazine-2-carbonyl]amino]methyl]phenoxy]hexanoic acid (PubChem CID 123731747) has the molecular formula C22H25N3O7 and a molecular weight of 443.46 g/mol. Its IUPAC name is 6-[2-[[[5-(furan-2-yl)-3,6-dioxopiperazine-2-carbonyl]amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[[5-(furan-2-yl)-3,6-dioxopiperazine-2-carbonyl]amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 123731747 |
| Molecular Formula | C22H25N3O7 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 6-[2-[[[5-(furan-2-yl)-3,6-dioxopiperazine-2-carbonyl]amino]methyl]phenoxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccccc1CNC(=O)C1NC(=O)C(c2ccco2)NC1=O |
| InChI | InChI=1S/C22H25N3O7/c26-17(27)10-2-1-5-11-31-15-8-4-3-7-14(15)13-23-20(28)19-22(30)24-18(21(29)25-19)16-9-6-12-32-16/h3-4,6-9,12,18-19H,1-2,5,10-11,13H2,(H,23,28)(H,24,30)(H,25,29)(H,26,27) |
| InChIKey | NJHXYRLJNYEFRS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|