C22H27NO5 — CID 20994233
4-oxo-4-[[2-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methylamino]butanoic acid (PubChem CID 20994233) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-oxo-4-[[2-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methylamino]butanoic acid.
| Compound Name | 4-oxo-4-[[2-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 20994233 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-oxo-4-[[2-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methylamino]butanoic acid |
| SMILES | Cc1cc(C)c(C)c(OCCOc2ccccc2CNC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C22H27NO5/c1-15-12-16(2)17(3)20(13-15)28-11-10-27-19-7-5-4-6-18(19)14-23-21(24)8-9-22(25)26/h4-7,12-13H,8-11,14H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | GLPDEVQDHNOUHF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|