C22H27NO5 — CID 20987534
4-[2-[2-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid (PubChem CID 20987534) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-[2-[2-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20987534 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-[2-[2-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]ethylamino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(C)c(OCCOc2ccccc2CCNC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C22H27NO5/c1-16-7-8-17(2)20(15-16)28-14-13-27-19-6-4-3-5-18(19)11-12-23-21(24)9-10-22(25)26/h3-8,15H,9-14H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | AXRNWKROCHMHPH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|