C34H40N2O5 — CID 130304044
6-[2-[2-(tert-butylamino)-1-[cyclopropyl-(4-phenylbenzoyl)amino]-1-deuterio-2-oxoethyl]phenoxy]hexanoic acid (PubChem CID 130304044) has the molecular formula C34H40N2O5 and a molecular weight of 557.71 g/mol. Its IUPAC name is 6-[2-[2-(tert-butylamino)-1-[cyclopropyl-(4-phenylbenzoyl)amino]-1-deuterio-2-oxoethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[2-(tert-butylamino)-1-[cyclopropyl-(4-phenylbenzoyl)amino]-1-deuterio-2-oxoethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 130304044 |
| Molecular Formula | C34H40N2O5 |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | 6-[2-[2-(tert-butylamino)-1-[cyclopropyl-(4-phenylbenzoyl)amino]-1-deuterio-2-oxoethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(C(=O)NC(C)(C)C)(c1ccccc1OCCCCCC(=O)O)N(C(=O)c1ccc(-c2ccccc2)cc1)C1CC1 |
| InChI | InChI=1S/C34H40N2O5/c1-34(2,3)35-32(39)31(28-14-9-10-15-29(28)41-23-11-5-8-16-30(37)38)36(27-21-22-27)33(40)26-19-17-25(18-20-26)24-12-6-4-7-13-24/h4,6-7,9-10,12-15,17-20,27,31H,5,8,11,16,21-23H2,1-3H3,(H,35,39)(H,37,38)/i31D |
| InChIKey | MZNGPIDPPFSDJD-BTVGIEKFSA-N |
| XLogP | 6.64 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|