C32H42N2O7 — CID 145060830
formic acid;4-(furan-3-yl)-N-[(2-hexoxyphenyl)-hydroxymethyl]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 145060830) has the molecular formula C32H42N2O7 and a molecular weight of 566.70 g/mol. Its IUPAC name is formic acid;4-(furan-3-yl)-N-[(2-hexoxyphenyl)-hydroxymethyl]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | formic acid;4-(furan-3-yl)-N-[(2-hexoxyphenyl)-hydroxymethyl]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 145060830 |
| Molecular Formula | C32H42N2O7 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | formic acid;4-(furan-3-yl)-N-[(2-hexoxyphenyl)-hydroxymethyl]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | CCCCCCOc1ccccc1C(O)N(CCCN1CCOCC1)C(=O)c1ccc(-c2ccoc2)cc1.O=CO |
| InChI | InChI=1S/C31H40N2O5.CH2O2/c1-2-3-4-7-20-38-29-10-6-5-9-28(29)31(35)33(17-8-16-32-18-22-36-23-19-32)30(34)26-13-11-25(12-14-26)27-15-21-37-24-27;2-1-3/h5-6,9-15,21,24,31,35H,2-4,7-8,16-20,22-23H2,1H3;1H,(H,2,3) |
| InChIKey | RBJIWFMUEUMHEF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|