C31H40N2O4S — CID 145061262
N-[(2-hexoxyphenyl)-hydroxymethyl]-N-(3-morpholin-4-ylpropyl)-4-thiophen-3-ylbenzamide (PubChem CID 145061262) has the molecular formula C31H40N2O4S and a molecular weight of 536.74 g/mol. Its IUPAC name is N-[(2-hexoxyphenyl)-hydroxymethyl]-N-(3-morpholin-4-ylpropyl)-4-thiophen-3-ylbenzamide.
| Compound Name | N-[(2-hexoxyphenyl)-hydroxymethyl]-N-(3-morpholin-4-ylpropyl)-4-thiophen-3-ylbenzamide |
|---|---|
| PubChem CID | 145061262 |
| Molecular Formula | C31H40N2O4S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | N-[(2-hexoxyphenyl)-hydroxymethyl]-N-(3-morpholin-4-ylpropyl)-4-thiophen-3-ylbenzamide |
| SMILES | CCCCCCOc1ccccc1C(O)N(CCCN1CCOCC1)C(=O)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C31H40N2O4S/c1-2-3-4-7-20-37-29-10-6-5-9-28(29)31(35)33(17-8-16-32-18-21-36-22-19-32)30(34)26-13-11-25(12-14-26)27-15-23-38-24-27/h5-6,9-15,23-24,31,35H,2-4,7-8,16-22H2,1H3 |
| InChIKey | ADTCJVOWHZSUJE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|