C32H36N2O7 — CID 145060891
N-[dihydroxy(phenyl)methyl]-4-(furan-3-yl)-N-[(2-hexoxyphenyl)methyl]benzamide;N-hydroxyformamide (PubChem CID 145060891) has the molecular formula C32H36N2O7 and a molecular weight of 560.65 g/mol. Its IUPAC name is N-[dihydroxy(phenyl)methyl]-4-(furan-3-yl)-N-[(2-hexoxyphenyl)methyl]benzamide;N-hydroxyformamide.
| Compound Name | N-[dihydroxy(phenyl)methyl]-4-(furan-3-yl)-N-[(2-hexoxyphenyl)methyl]benzamide;N-hydroxyformamide |
|---|---|
| PubChem CID | 145060891 |
| Molecular Formula | C32H36N2O7 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | N-[dihydroxy(phenyl)methyl]-4-(furan-3-yl)-N-[(2-hexoxyphenyl)methyl]benzamide;N-hydroxyformamide |
| SMILES | CCCCCCOc1ccccc1CN(C(=O)c1ccc(-c2ccoc2)cc1)C(O)(O)c1ccccc1.O=CNO |
| InChI | InChI=1S/C31H33NO5.CH3NO2/c1-2-3-4-10-20-37-29-14-9-8-11-26(29)22-32(31(34,35)28-12-6-5-7-13-28)30(33)25-17-15-24(16-18-25)27-19-21-36-23-27;3-1-2-4/h5-9,11-19,21,23,34-35H,2-4,10,20,22H2,1H3;1,4H,(H,2,3) |
| InChIKey | ZPGYKSCHWRQRLT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 132.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|