C30H35N3O4 — CID 145060771
4-(1-amino-3-iminoprop-1-en-2-yl)-N-[dihydroxy(phenyl)methyl]-N-[(2-hexoxyphenyl)methyl]benzamide (PubChem CID 145060771) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is 4-(1-amino-3-iminoprop-1-en-2-yl)-N-[dihydroxy(phenyl)methyl]-N-[(2-hexoxyphenyl)methyl]benzamide.
| Compound Name | 4-(1-amino-3-iminoprop-1-en-2-yl)-N-[dihydroxy(phenyl)methyl]-N-[(2-hexoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 145060771 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 4-(1-amino-3-iminoprop-1-en-2-yl)-N-[dihydroxy(phenyl)methyl]-N-[(2-hexoxyphenyl)methyl]benzamide |
| SMILES | [H]/N=C/C(=CN)c1ccc(C(=O)N(Cc2ccccc2OCCCCCC)C(O)(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H35N3O4/c1-2-3-4-10-19-37-28-14-9-8-11-25(28)22-33(30(35,36)27-12-6-5-7-13-27)29(34)24-17-15-23(16-18-24)26(20-31)21-32/h5-9,11-18,20-21,31,35-36H,2-4,10,19,22,32H2,1H3/b26-21?,31-20+ |
| InChIKey | WSSBYPNZJGDCPD-BKHZCOATSA-N |
| XLogP | 5.03 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|