C29H32N4O3 — CID 121270812
6-[2-[[N-(1-deuterio-2-pyridin-2-ylethyl)-4-(1H-pyrazol-4-yl)anilino]methyl]phenoxy]hexanoic acid (PubChem CID 121270812) has the molecular formula C29H32N4O3 and a molecular weight of 485.61 g/mol. Its IUPAC name is 6-[2-[[N-(1-deuterio-2-pyridin-2-ylethyl)-4-(1H-pyrazol-4-yl)anilino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[N-(1-deuterio-2-pyridin-2-ylethyl)-4-(1H-pyrazol-4-yl)anilino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270812 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 6-[2-[[N-(1-deuterio-2-pyridin-2-ylethyl)-4-(1H-pyrazol-4-yl)anilino]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(Cc1ccccn1)N(Cc1ccccc1OCCCCCC(=O)O)c1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C29H32N4O3/c34-29(35)11-2-1-7-19-36-28-10-4-3-8-24(28)22-33(18-16-26-9-5-6-17-30-26)27-14-12-23(13-15-27)25-20-31-32-21-25/h3-6,8-10,12-15,17,20-21H,1-2,7,11,16,18-19,22H2,(H,31,32)(H,34,35)/i18D |
| InChIKey | JEQPFPGHDIIXMP-VAAKKRCDSA-N |
| XLogP | 5.74 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|