C30H32N4O4 — CID 121270741
N-[dideuterio(phenyl)methyl]-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]-4-(1H-pyrazol-4-yl)benzamide (PubChem CID 121270741) has the molecular formula C30H32N4O4 and a molecular weight of 514.62 g/mol. Its IUPAC name is N-[dideuterio(phenyl)methyl]-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]-4-(1H-pyrazol-4-yl)benzamide.
| Compound Name | N-[dideuterio(phenyl)methyl]-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]-4-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 121270741 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | N-[dideuterio(phenyl)methyl]-N-[[2-[6-(hydroxyamino)-6-oxohexoxy]phenyl]methyl]-4-(1H-pyrazol-4-yl)benzamide |
| SMILES | [2H]C([2H])(c1ccccc1)N(Cc1ccccc1OCCCCCC(=O)NO)C(=O)c1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C30H32N4O4/c35-29(33-37)13-5-2-8-18-38-28-12-7-6-11-26(28)22-34(21-23-9-3-1-4-10-23)30(36)25-16-14-24(15-17-25)27-19-31-32-20-27/h1,3-4,6-7,9-12,14-17,19-20,37H,2,5,8,13,18,21-22H2,(H,31,32)(H,33,35)/i21D2 |
| InChIKey | IANWWROJTBNOKJ-GQZVJHRESA-N |
| XLogP | 5.36 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|