C34H35NO4 — CID 157202407
N-[deuterio(phenyl)methyl]-N-[[2-(7-hydroxy-6-oxoheptoxy)phenyl]methyl]-4-phenylbenzamide (PubChem CID 157202407) has the molecular formula C34H35NO4 and a molecular weight of 522.66 g/mol. Its IUPAC name is N-[deuterio(phenyl)methyl]-N-[[2-(7-hydroxy-6-oxoheptoxy)phenyl]methyl]-4-phenylbenzamide.
| Compound Name | N-[deuterio(phenyl)methyl]-N-[[2-(7-hydroxy-6-oxoheptoxy)phenyl]methyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 157202407 |
| Molecular Formula | C34H35NO4 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | N-[deuterio(phenyl)methyl]-N-[[2-(7-hydroxy-6-oxoheptoxy)phenyl]methyl]-4-phenylbenzamide |
| SMILES | [2H]C(c1ccccc1)N(Cc1ccccc1OCCCCCC(=O)CO)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H35NO4/c36-26-32(37)17-8-3-11-23-39-33-18-10-9-16-31(33)25-35(24-27-12-4-1-5-13-27)34(38)30-21-19-29(20-22-30)28-14-6-2-7-15-28/h1-2,4-7,9-10,12-16,18-22,36H,3,8,11,17,23-26H2/i24D |
| InChIKey | VABQVBUGYHSZOB-CORJAIEOSA-N |
| XLogP | 6.70 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|