C28H33NO5 — CID 121270611
6-[2-[dideuterio-[[4-[2-(oxetan-3-yl)ethynyl]benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoic acid (PubChem CID 121270611) has the molecular formula C28H33NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is 6-[2-[dideuterio-[[4-[2-(oxetan-3-yl)ethynyl]benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[dideuterio-[[4-[2-(oxetan-3-yl)ethynyl]benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270611 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 6-[2-[dideuterio-[[4-[2-(oxetan-3-yl)ethynyl]benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoic acid |
| SMILES | [2H]C([2H])(c1ccccc1OCCCCCC(=O)O)N(C(=O)c1ccc(C#CC2COC2)cc1)C(C)C |
| InChI | InChI=1S/C28H33NO5/c1-21(2)29(28(32)24-15-13-22(14-16-24)11-12-23-19-33-20-23)18-25-8-5-6-9-26(25)34-17-7-3-4-10-27(30)31/h5-6,8-9,13-16,21,23H,3-4,7,10,17-20H2,1-2H3,(H,30,31)/i18D2 |
| InChIKey | ROZIYUWXQSXUAG-CPLZMPMBSA-N |
| XLogP | 4.76 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|