C27H33NO3 — CID 121270482
6-[2-[[4-(2-cyclopropylethynyl)-N-propan-2-ylanilino]-deuteriomethyl]phenoxy]hexanoic acid (PubChem CID 121270482) has the molecular formula C27H33NO3 and a molecular weight of 420.57 g/mol. Its IUPAC name is 6-[2-[[4-(2-cyclopropylethynyl)-N-propan-2-ylanilino]-deuteriomethyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[4-(2-cyclopropylethynyl)-N-propan-2-ylanilino]-deuteriomethyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 121270482 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 6-[2-[[4-(2-cyclopropylethynyl)-N-propan-2-ylanilino]-deuteriomethyl]phenoxy]hexanoic acid |
| SMILES | [2H]C(c1ccccc1OCCCCCC(=O)O)N(c1ccc(C#CC2CC2)cc1)C(C)C |
| InChI | InChI=1S/C27H33NO3/c1-21(2)28(25-17-15-23(16-18-25)14-13-22-11-12-22)20-24-8-5-6-9-26(24)31-19-7-3-4-10-27(29)30/h5-6,8-9,15-18,21-22H,3-4,7,10-12,19-20H2,1-2H3,(H,29,30)/i20D |
| InChIKey | HPYUFHDDAVTTRX-YVHRXSIGSA-N |
| XLogP | 5.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|