C30H35B2NO4 — CID 145061050
CID 145061050 (PubChem CID 145061050) has the molecular formula C30H35B2NO4 and a molecular weight of 495.24 g/mol.
| Compound Name | CID 145061050 |
|---|---|
| PubChem CID | 145061050 |
| Molecular Formula | C30H35B2NO4 |
| Molecular Weight | 495.24 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1ccccc1OCCCCCC(=O)O)N(C(=O)c1ccc(C#CC2CCCC2)cc1)C(C)C |
| InChI | InChI=1S/C30H35B2NO4/c1-22(2)33(29(36)25-19-17-24(18-20-25)16-15-23-10-5-6-11-23)30(31,32)26-12-7-8-13-27(26)37-21-9-3-4-14-28(34)35/h7-8,12-13,17-20,22-23H,3-6,9-11,14,21H2,1-2H3,(H,34,35) |
| InChIKey | GKAISAHRDUSWPM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.24 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|