C22H28N2O6 — CID 123651894
6-[4-[[[4-(furan-2-yl)benzoyl]amino]methyl]morpholin-3-yl]oxyhexanoic acid (PubChem CID 123651894) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 6-[4-[[[4-(furan-2-yl)benzoyl]amino]methyl]morpholin-3-yl]oxyhexanoic acid.
| Compound Name | 6-[4-[[[4-(furan-2-yl)benzoyl]amino]methyl]morpholin-3-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 123651894 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 6-[4-[[[4-(furan-2-yl)benzoyl]amino]methyl]morpholin-3-yl]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOC1COCCN1CNC(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C22H28N2O6/c25-21(26)6-2-1-3-12-30-20-15-28-14-11-24(20)16-23-22(27)18-9-7-17(8-10-18)19-5-4-13-29-19/h4-5,7-10,13,20H,1-3,6,11-12,14-16H2,(H,23,27)(H,25,26) |
| InChIKey | GBZZOKZOEWAIMJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|