C19H21N3O5 — CID 3887037
4-(furan-2-yl)-N'-(4-morpholin-4-yl-4-oxobutanoyl)benzohydrazide (PubChem CID 3887037) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-(furan-2-yl)-N'-(4-morpholin-4-yl-4-oxobutanoyl)benzohydrazide.
| Compound Name | 4-(furan-2-yl)-N'-(4-morpholin-4-yl-4-oxobutanoyl)benzohydrazide |
|---|---|
| PubChem CID | 3887037 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-(furan-2-yl)-N'-(4-morpholin-4-yl-4-oxobutanoyl)benzohydrazide |
| SMILES | O=C(CCC(=O)N1CCOCC1)NNC(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C19H21N3O5/c23-17(7-8-18(24)22-9-12-26-13-10-22)20-21-19(25)15-5-3-14(4-6-15)16-2-1-11-27-16/h1-6,11H,7-10,12-13H2,(H,20,23)(H,21,25) |
| InChIKey | ZWXOMSSKRDVXMV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|