C21H22BrFN4O3 — CID 3304231
4-bromo-N'-[4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxobutanoyl]benzohydrazide (PubChem CID 3304231) has the molecular formula C21H22BrFN4O3 and a molecular weight of 477.33 g/mol. Its IUPAC name is 4-bromo-N'-[4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxobutanoyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxobutanoyl]benzohydrazide |
|---|---|
| PubChem CID | 3304231 |
| Molecular Formula | C21H22BrFN4O3 |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 4-bromo-N'-[4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxobutanoyl]benzohydrazide |
| SMILES | O=C(CCC(=O)N1CCN(c2ccc(F)cc2)CC1)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H22BrFN4O3/c22-16-3-1-15(2-4-16)21(30)25-24-19(28)9-10-20(29)27-13-11-26(12-14-27)18-7-5-17(23)6-8-18/h1-8H,9-14H2,(H,24,28)(H,25,30) |
| InChIKey | UPUPEYGXSCKNGA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|