C23H27FN4O3 — CID 3622193
4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxo-N'-(3-phenylpropanoyl)butanehydrazide (PubChem CID 3622193) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxo-N'-(3-phenylpropanoyl)butanehydrazide.
| Compound Name | 4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxo-N'-(3-phenylpropanoyl)butanehydrazide |
|---|---|
| PubChem CID | 3622193 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxo-N'-(3-phenylpropanoyl)butanehydrazide |
| SMILES | O=C(CCC(=O)N1CCN(c2ccc(F)cc2)CC1)NNC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C23H27FN4O3/c24-19-7-9-20(10-8-19)27-14-16-28(17-15-27)23(31)13-12-22(30)26-25-21(29)11-6-18-4-2-1-3-5-18/h1-5,7-10H,6,11-17H2,(H,25,29)(H,26,30) |
| InChIKey | TXNUVWDPWXZCBE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|