C21H25FN2O — CID 41448906
3-(4-ethylphenyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one (PubChem CID 41448906) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(4-ethylphenyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 41448906 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-(4-ethylphenyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
| SMILES | CCc1ccc(CCC(=O)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H25FN2O/c1-2-17-3-5-18(6-4-17)7-12-21(25)24-15-13-23(14-16-24)20-10-8-19(22)9-11-20/h3-6,8-11H,2,7,12-16H2,1H3 |
| InChIKey | PYOPDLLUKDINPL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |