C23H30FN3O — CID 109027223
3-[benzyl(propan-2-yl)amino]-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one (PubChem CID 109027223) has the molecular formula C23H30FN3O and a molecular weight of 383.51 g/mol. Its IUPAC name is 3-[benzyl(propan-2-yl)amino]-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-[benzyl(propan-2-yl)amino]-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 109027223 |
| Molecular Formula | C23H30FN3O |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 3-[benzyl(propan-2-yl)amino]-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
| SMILES | CC(C)N(CCC(=O)N1CCN(c2ccc(F)cc2)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C23H30FN3O/c1-19(2)27(18-20-6-4-3-5-7-20)13-12-23(28)26-16-14-25(15-17-26)22-10-8-21(24)9-11-22/h3-11,19H,12-18H2,1-2H3 |
| InChIKey | YNLWWWAYRGUGJS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |