C15H19FN4O3S — CID 9468842
1-(2-fluorophenyl)-3-[(4-morpholin-4-yl-4-oxobutanoyl)amino]thiourea (PubChem CID 9468842) has the molecular formula C15H19FN4O3S and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(4-morpholin-4-yl-4-oxobutanoyl)amino]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[(4-morpholin-4-yl-4-oxobutanoyl)amino]thiourea |
|---|---|
| PubChem CID | 9468842 |
| Molecular Formula | C15H19FN4O3S |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(4-morpholin-4-yl-4-oxobutanoyl)amino]thiourea |
| SMILES | O=C(CCC(=O)N1CCOCC1)NNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C15H19FN4O3S/c16-11-3-1-2-4-12(11)17-15(24)19-18-13(21)5-6-14(22)20-7-9-23-10-8-20/h1-4H,5-10H2,(H,18,21)(H2,17,19,24) |
| InChIKey | QGPOPPURUXDTCO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|