C16H24FN4O2S+ — CID 8785581
1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propanoylamino]-3-(2-fluorophenyl)thiourea (PubChem CID 8785581) has the molecular formula C16H24FN4O2S+ and a molecular weight of 355.46 g/mol. Its IUPAC name is 1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propanoylamino]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propanoylamino]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 8785581 |
| Molecular Formula | C16H24FN4O2S+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propanoylamino]-3-(2-fluorophenyl)thiourea |
| SMILES | C[C@@H]1C[NH+](CCC(=O)NNC(=S)Nc2ccccc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C16H23FN4O2S/c1-11-9-21(10-12(2)23-11)8-7-15(22)19-20-16(24)18-14-6-4-3-5-13(14)17/h3-6,11-12H,7-10H2,1-2H3,(H,19,22)(H2,18,20,24)/p+1/t11-,12+ |
| InChIKey | QOGWOMIQWXBQPU-TXEJJXNPSA-O |
| XLogP | 0.23 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|