C19H20FN3O3S — CID 9468701
1-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]-3-(2-fluorophenyl)thiourea (PubChem CID 9468701) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9468701 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]-3-(2-fluorophenyl)thiourea |
| SMILES | CCOc1ccc(C(=O)CCC(=O)NNC(=S)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C19H20FN3O3S/c1-2-26-14-9-7-13(8-10-14)17(24)11-12-18(25)22-23-19(27)21-16-6-4-3-5-15(16)20/h3-10H,2,11-12H2,1H3,(H,22,25)(H2,21,23,27) |
| InChIKey | VEJJQANGHPGKHU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|