C21H28N3O4+ — CID 9410455
3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-N'-(2-naphthalen-2-yloxyacetyl)propanehydrazide (PubChem CID 9410455) has the molecular formula C21H28N3O4+ and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-N'-(2-naphthalen-2-yloxyacetyl)propanehydrazide.
| Compound Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-N'-(2-naphthalen-2-yloxyacetyl)propanehydrazide |
|---|---|
| PubChem CID | 9410455 |
| Molecular Formula | C21H28N3O4+ |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-N'-(2-naphthalen-2-yloxyacetyl)propanehydrazide |
| SMILES | C[C@@H]1C[NH+](CCC(=O)NNC(=O)COc2ccc3ccccc3c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C21H27N3O4/c1-15-12-24(13-16(2)28-15)10-9-20(25)22-23-21(26)14-27-19-8-7-17-5-3-4-6-18(17)11-19/h3-8,11,15-16H,9-10,12-14H2,1-2H3,(H,22,25)(H,23,26)/p+1/t15-,16-/m1/s1 |
| InChIKey | JCWVJIVXBUEJRW-HZPDHXFCSA-O |
| XLogP | 0.45 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|