C23H31N4O4+ — CID 9410333
N-[2-[2-[3-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propanoyl]hydrazinyl]-2-oxoethyl]-2-naphthalen-1-ylacetamide (PubChem CID 9410333) has the molecular formula C23H31N4O4+ and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[2-[2-[3-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propanoyl]hydrazinyl]-2-oxoethyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[2-[2-[3-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propanoyl]hydrazinyl]-2-oxoethyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 9410333 |
| Molecular Formula | C23H31N4O4+ |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[2-[2-[3-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]propanoyl]hydrazinyl]-2-oxoethyl]-2-naphthalen-1-ylacetamide |
| SMILES | C[C@H]1C[NH+](CCC(=O)NNC(=O)CNC(=O)Cc2cccc3ccccc23)C[C@H](C)O1 |
| InChI | InChI=1S/C23H30N4O4/c1-16-14-27(15-17(2)31-16)11-10-21(28)25-26-23(30)13-24-22(29)12-19-8-5-7-18-6-3-4-9-20(18)19/h3-9,16-17H,10-15H2,1-2H3,(H,24,29)(H,25,28)(H,26,30)/p+1/t16-,17-/m0/s1 |
| InChIKey | FZHCFRNGXQWXLP-IRXDYDNUSA-O |
| XLogP | -0.27 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|