C18H24Cl2N3O3+ — CID 9410443
N'-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]propanehydrazide (PubChem CID 9410443) has the molecular formula C18H24Cl2N3O3+ and a molecular weight of 401.31 g/mol. Its IUPAC name is N'-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]propanehydrazide.
| Compound Name | N'-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]propanehydrazide |
|---|---|
| PubChem CID | 9410443 |
| Molecular Formula | C18H24Cl2N3O3+ |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N'-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]propanehydrazide |
| SMILES | C[C@@H]1C[NH+](CCC(=O)NNC(=O)/C=C/c2ccc(Cl)c(Cl)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H23Cl2N3O3/c1-12-10-23(11-13(2)26-12)8-7-18(25)22-21-17(24)6-4-14-3-5-15(19)16(20)9-14/h3-6,9,12-13H,7-8,10-11H2,1-2H3,(H,21,24)(H,22,25)/p+1/b6-4+/t12-,13-/m1/s1 |
| InChIKey | NAVWCNFGTDWEOI-LOWFTVKWSA-O |
| XLogP | 1.24 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|