C15H17Cl2NO6 — CID 67974534
(E)-3-(3,4-dichlorophenyl)-N-[(2S,3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide (PubChem CID 67974534) has the molecular formula C15H17Cl2NO6 and a molecular weight of 378.21 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[(2S,3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[(2S,3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67974534 |
| Molecular Formula | C15H17Cl2NO6 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[(2S,3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)N[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C15H17Cl2NO6/c16-8-3-1-7(5-9(8)17)2-4-11(20)18-12-14(22)13(21)10(6-19)24-15(12)23/h1-5,10,12-15,19,21-23H,6H2,(H,18,20)/b4-2+/t10-,12+,13-,14-,15+/m1/s1 |
| InChIKey | ZBHWRKZTEDNOAJ-IQMHZTNFSA-N |
| XLogP | -0.08 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|