C18H23NO8 — CID 123888481
methyl 4-[3-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-3-oxoprop-1-enyl]benzoate (PubChem CID 123888481) has the molecular formula C18H23NO8 and a molecular weight of 381.38 g/mol. Its IUPAC name is methyl 4-[3-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[3-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 123888481 |
| Molecular Formula | C18H23NO8 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | methyl 4-[3-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C=CC(=O)NC2C(OC)OC(CO)C(O)C2O)cc1 |
| InChI | InChI=1S/C18H23NO8/c1-25-17(24)11-6-3-10(4-7-11)5-8-13(21)19-14-16(23)15(22)12(9-20)27-18(14)26-2/h3-8,12,14-16,18,20,22-23H,9H2,1-2H3,(H,19,21) |
| InChIKey | PSQQFFSDFISSOX-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|