C16H20Cl2N2O5 — CID 123260350
N-[(2S,3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 123260350) has the molecular formula C16H20Cl2N2O5 and a molecular weight of 391.25 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 123260350 |
| Molecular Formula | C16H20Cl2N2O5 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | CO[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1NC(=O)C=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2O5/c1-24-16-13(15(23)14(22)11(7-19)25-16)20-12(21)5-3-8-2-4-9(17)10(18)6-8/h2-6,11,13-16,22-23H,7,19H2,1H3,(H,20,21)/t11-,13-,14-,15-,16+/m1/s1 |
| InChIKey | HBWRNXOKWHOBKH-BTAUDXDXSA-N |
| XLogP | 0.54 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|