C18H25NO8 — CID 123273578
3-(3,4-dimethoxyphenyl)-N-[(3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl]prop-2-enamide (PubChem CID 123273578) has the molecular formula C18H25NO8 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[(3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[(3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 123273578 |
| Molecular Formula | C18H25NO8 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[(3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCC2OC(OC)C(O)C(O)C2O)cc1OC |
| InChI | InChI=1S/C18H25NO8/c1-24-11-6-4-10(8-12(11)25-2)5-7-14(20)19-9-13-15(21)16(22)17(23)18(26-3)27-13/h4-8,13,15-18,21-23H,9H2,1-3H3,(H,19,20) |
| InChIKey | MSOXNRHEAAYSSF-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|