C17H23NO7 — CID 123706681
3-(2-methoxyphenyl)-N-[(3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl]prop-2-enamide (PubChem CID 123706681) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-[(3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl]prop-2-enamide.
| Compound Name | 3-(2-methoxyphenyl)-N-[(3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 123706681 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-[(3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl]prop-2-enamide |
| SMILES | COc1ccccc1C=CC(=O)NCC1OC(OC)C(O)C(O)C1O |
| InChI | InChI=1S/C17H23NO7/c1-23-11-6-4-3-5-10(11)7-8-13(19)18-9-12-14(20)15(21)16(22)17(24-2)25-12/h3-8,12,14-17,20-22H,9H2,1-2H3,(H,18,19) |
| InChIKey | ZMXCIHTZOFTCMB-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|