C15H17Cl2NO5 — CID 127052625
(E)-3-(3,4-dichlorophenyl)-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide (PubChem CID 127052625) has the molecular formula C15H17Cl2NO5 and a molecular weight of 362.21 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 127052625 |
| Molecular Formula | C15H17Cl2NO5 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[(3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)N[C@H]1CO[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H17Cl2NO5/c16-9-3-1-8(5-10(9)17)2-4-13(20)18-11-7-23-12(6-19)15(22)14(11)21/h1-5,11-12,14-15,19,21-22H,6-7H2,(H,18,20)/b4-2+/t11-,12+,14+,15+/m0/s1 |
| InChIKey | MDRADRFVHCEAIO-ALMBQQNPSA-N |
| XLogP | 0.60 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|