C27H29Cl2N3O7S — CID 57411564
(E)-3-(3,4-dichlorophenyl)-N-[(3R,4R,5S,6R)-6-[[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]prop-2-enamide (PubChem CID 57411564) has the molecular formula C27H29Cl2N3O7S and a molecular weight of 610.52 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[(3R,4R,5S,6R)-6-[[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[(3R,4R,5S,6R)-6-[[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 57411564 |
| Molecular Formula | C27H29Cl2N3O7S |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[(3R,4R,5S,6R)-6-[[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]prop-2-enamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NC[C@H]3OC(O)[C@H](NC(=O)/C=C/c4ccc(Cl)c(Cl)c4)[C@@H](O)[C@@H]3O)cccc12 |
| InChI | InChI=1S/C27H29Cl2N3O7S/c1-32(2)20-7-3-6-17-16(20)5-4-8-22(17)40(37,38)30-14-21-25(34)26(35)24(27(36)39-21)31-23(33)12-10-15-9-11-18(28)19(29)13-15/h3-13,21,24-27,30,34-36H,14H2,1-2H3,(H,31,33)/b12-10+/t21-,24-,25-,26-,27?/m1/s1 |
| InChIKey | TWSZARNOTFXTBS-RQYAPBHESA-N |
| XLogP | 2.13 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|