C25H33N4O2+ — CID 9150830
3-(4-phenylpiperazin-1-ium-1-yl)-N'-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]propanehydrazide (PubChem CID 9150830) has the molecular formula C25H33N4O2+ and a molecular weight of 421.57 g/mol. Its IUPAC name is 3-(4-phenylpiperazin-1-ium-1-yl)-N'-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]propanehydrazide.
| Compound Name | 3-(4-phenylpiperazin-1-ium-1-yl)-N'-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 9150830 |
| Molecular Formula | C25H33N4O2+ |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 3-(4-phenylpiperazin-1-ium-1-yl)-N'-[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]propanehydrazide |
| SMILES | CC(C)c1ccc(/C=C/C(=O)NNC(=O)CC[NH+]2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H32N4O2/c1-20(2)22-11-8-21(9-12-22)10-13-24(30)26-27-25(31)14-15-28-16-18-29(19-17-28)23-6-4-3-5-7-23/h3-13,20H,14-19H2,1-2H3,(H,26,30)(H,27,31)/p+1/b13-10+ |
| InChIKey | LBHNSWHBOGMYMB-JLHYYAGUSA-O |
| XLogP | 1.77 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|